| Name | Zinc Fumarate |
| Synonyms | Zincfumarat Fumaratezinc ZINC FUMARATE Zinc Fumarate FUMARIC ACID, ZINC SALT zinc (2Z)-but-2-enedioate |
| CAS | 52723-61-2 |
| EINECS | 258-134-2 |
| InChI | InChI=1/C4H4O4.Zn/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1- |
| Molecular Formula | C4H2O4Zn |
| Molar Mass | 179.45 |
| Boling Point | 355.5°C at 760 mmHg |
| Flash Point | 183°C |
| Vapor Presure | 5.19E-06mmHg at 25°C |
| Application | The organic zinc source feed additive formed by the combination of fumaric acid (H2C4H2O) and zinc ions is a biologically active substance. Adding it to the feed has the effects of anti-mildew, antibacterial, improving feed utilization rate and livestock and poultry production performance, and at the same time has the characteristics of no stimulation and fast absorption, it belongs to an animal zinc supplement enhancer with excellent performance. The fumarate ion in zinc fumarate can participate in the tricarboxylic acid cycle to form ATP for the body's metabolism. It can be used as a carbon frame to synthesize amino acids and further synthesize proteins. |